InChI | ||
---|---|---|
Nap | Naphthalene | InChI=1/C10H4Cl4/c11-7-5-3-1-2-4-6(5)8(12)10(14)9(7)13/h1-4H |
Ace | Acenaphthene | InChI=1/C12H10/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-6H,7-8H2 |
Flo | Fluorene | InChI=1/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2 |
Phe | Phenanthrene | InChI=1/C14H10/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13/h1-10H |
Ant | Anthracene | InChI=1/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H |
Flu | Fluoranthene | InChI=1/C16H10/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14/h1-10H |
Pyr | Pyrene | InChI=1/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H |
BaA | Benzo [a]anthracene | InChI=1/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H |
Chr | Chrysene | InChI=1/C18H12/c1-3-7-15-13(5-1)9-11-18-16-8-4-2-6-14(16)10-12-17(15)18/h1-12H |
BkF | Benzo [k]fluoranthene | InChI=1/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H |
BaP | Benzo [a]pyrene | InChI=1/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H |
Ind | Indeno [1,2,3-cd]pyrene | InChI=1/C22H12/c1-2-7-17-16(6-1)18-11-10-14-9-8-13-4-3-5-15-12-19(17)22(18)21(14)20(13)15/h1-12H |
PAH | Polycyclic Aromatic Hydrocarbon | |
PDMS | PolyDiMethylSiloxane | |
MeOH | Methanol | |
aq | Water | |
free | Water | |
p | Polymer | |
Unit | ||
SPME | Solid Phase Micro-Extraction | |
ESD | Eqilibrium Sampling Device | |
A/V | (surface)Area to Volume ratio | m-1 |
LoQ | Limit of Quantification | |
QA/QC | Quality Assurance/Quality Control | |
PTFE | PolyTetraFluoroEthylene | |
a | Chemical (thermodynamic) activity | |
γi | Activity coefficient in phase i | M-1 |
K i/j | Partition ratio between phases i and j | L/L |
C i | Concentration in (phase) i | M |
T | Thermodynamic temperature | K |
Tm | Melting point temperature | K |
Vi | Volume of phase i | L |
na | Amount of analyte | mol |
S(s)i | Solubility (solid) in phase i | M |
n | number of replicate determinations | |
r2 | Goodness of fit |